C19H21F3 — CID 23197854
1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 23197854) has the molecular formula C19H21F3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexa-2,4-dien-1-yl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexa-2,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 23197854 |
| Molecular Formula | C19H21F3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | CC1CCC(C2=CCC(c3cc(F)c(F)c(F)c3)C=C2)CC1 |
| InChI | InChI=1S/C19H21F3/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)16-10-17(20)19(22)18(21)11-16/h6-8,10-13,15H,2-5,9H2,1H3 |
| InChIKey | AKSHELQHJGSCBP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|