C20H18F6 — CID 21134601
5-[difluoro-[2-fluoro-4-(4-methylcyclohexyl)phenyl]methyl]-1,2,3-trifluorobenzene (PubChem CID 21134601) has the molecular formula C20H18F6 and a molecular weight of 372.35 g/mol. Its IUPAC name is 5-[difluoro-[2-fluoro-4-(4-methylcyclohexyl)phenyl]methyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[difluoro-[2-fluoro-4-(4-methylcyclohexyl)phenyl]methyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 21134601 |
| Molecular Formula | C20H18F6 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-[difluoro-[2-fluoro-4-(4-methylcyclohexyl)phenyl]methyl]-1,2,3-trifluorobenzene |
| SMILES | CC1CCC(c2ccc(C(F)(F)c3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C20H18F6/c1-11-2-4-12(5-3-11)13-6-7-15(16(21)8-13)20(25,26)14-9-17(22)19(24)18(23)10-14/h6-12H,2-5H2,1H3 |
| InChIKey | LFGFGUNGRBHINJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|