C23H34O — CID 144725591
(E)-3-[6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]prop-2-enal (PubChem CID 144725591) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is (E)-3-[6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]prop-2-enal.
| Compound Name | (E)-3-[6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 144725591 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (E)-3-[6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]prop-2-enal |
| SMILES | CC1CCC(C2CCC(C3=CC(C)C(/C=C/C=O)C=C3)CC2)CC1 |
| InChI | InChI=1S/C23H34O/c1-17-5-7-20(8-6-17)21-10-12-22(13-11-21)23-14-9-19(4-3-15-24)18(2)16-23/h3-4,9,14-22H,5-8,10-13H2,1-2H3/b4-3+ |
| InChIKey | VNTMYCKUWKTWFA-ONEGZZNKSA-N |
| XLogP | 6.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|