About S-benzamido 4-(methylamino)benzenecarbothioate
S-benzamido 4-(methylamino)benzenecarbothioate (PubChem CID 144902853) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is S-benzamido 4-(methylamino)benzenecarbothioate.
Molecular Properties
| Compound Name | S-benzamido 4-(methylamino)benzenecarbothioate |
| PubChem CID | 144902853 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | S-benzamido 4-(methylamino)benzenecarbothioate |
| SMILES | CNc1ccc(C(=O)SNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14N2O2S/c1-16-13-9-7-12(8-10-13)15(19)20-17-14(18)11-5-3-2-4-6-11/h2-10,16H,1H3,(H,17,18) |
| InChIKey | HELDLOJJCYKCMA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzamido 4-(methylamino)benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzamido 4-(methylamino)benzenecarbothioate?
The IUPAC name of S-benzamido 4-(methylamino)benzenecarbothioate (CID 144902853) is S-benzamido 4-(methylamino)benzenecarbothioate.
What is the SMILES notation for S-benzamido 4-(methylamino)benzenecarbothioate?
The canonical SMILES for S-benzamido 4-(methylamino)benzenecarbothioate is CNc1ccc(C(=O)SNC(=O)c2ccccc2)cc1.
What is the InChIKey of S-benzamido 4-(methylamino)benzenecarbothioate?
The InChIKey is HELDLOJJCYKCMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-16-13-9-7-12(8-10-13)15(19)20-17-14(18)11-5-3-2-4-6-11/h2-10,16H,1H3,(H,17,18).
What are the key properties of S-benzamido 4-(methylamino)benzenecarbothioate?
S-benzamido 4-(methylamino)benzenecarbothioate has a molecular weight of 286.36 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzamido 4-(methylamino)benzenecarbothioate is sourced from PubChem (CID 144902853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).