About S-benzamido 2-phenylpropanethioate
S-benzamido 2-phenylpropanethioate (PubChem CID 57378555) has the molecular formula C16H15NO2S
and a molecular weight of 285.37 g/mol. Its IUPAC name is S-benzamido 2-phenylpropanethioate.
Molecular Properties
| Compound Name | S-benzamido 2-phenylpropanethioate |
| PubChem CID | 57378555 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | S-benzamido 2-phenylpropanethioate |
| SMILES | CC(C(=O)SNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15NO2S/c1-12(13-8-4-2-5-9-13)16(19)20-17-15(18)14-10-6-3-7-11-14/h2-12H,1H3,(H,17,18) |
| InChIKey | RAVZIIJXAUKDPU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzamido 2-phenylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzamido 2-phenylpropanethioate?
The IUPAC name of S-benzamido 2-phenylpropanethioate (CID 57378555) is S-benzamido 2-phenylpropanethioate.
What is the SMILES notation for S-benzamido 2-phenylpropanethioate?
The canonical SMILES for S-benzamido 2-phenylpropanethioate is CC(C(=O)SNC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of S-benzamido 2-phenylpropanethioate?
The InChIKey is RAVZIIJXAUKDPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2S/c1-12(13-8-4-2-5-9-13)16(19)20-17-15(18)14-10-6-3-7-11-14/h2-12H,1H3,(H,17,18).
What are the key properties of S-benzamido 2-phenylpropanethioate?
S-benzamido 2-phenylpropanethioate has a molecular weight of 285.37 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzamido 2-phenylpropanethioate is sourced from PubChem (CID 57378555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).