C14H20N2O — CID 144903948
(3R)-N,3-dimethyl-N-pyridin-2-ylcyclohexane-1-carboxamide (PubChem CID 144903948) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (3R)-N,3-dimethyl-N-pyridin-2-ylcyclohexane-1-carboxamide.
| Compound Name | (3R)-N,3-dimethyl-N-pyridin-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 144903948 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (3R)-N,3-dimethyl-N-pyridin-2-ylcyclohexane-1-carboxamide |
| SMILES | C[C@@H]1CCCC(C(=O)N(C)c2ccccn2)C1 |
| InChI | InChI=1S/C14H20N2O/c1-11-6-5-7-12(10-11)14(17)16(2)13-8-3-4-9-15-13/h3-4,8-9,11-12H,5-7,10H2,1-2H3/t11-,12?/m1/s1 |
| InChIKey | DWNIRZKDOKADLO-JHJMLUEUSA-N |
| XLogP | 2.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |