C48H40N2O — CID 144907047
N-(4-cyclohexa-1,5-dien-1-ylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[4-(3,4,10,11-tetrahydro-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]aniline (PubChem CID 144907047) has the molecular formula C48H40N2O and a molecular weight of 660.86 g/mol. Its IUPAC name is N-(4-cyclohexa-1,5-dien-1-ylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[4-(3,4,10,11-tetrahydro-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]aniline.
| Compound Name | N-(4-cyclohexa-1,5-dien-1-ylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[4-(3,4,10,11-tetrahydro-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 144907047 |
| Molecular Formula | C48H40N2O |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | N-(4-cyclohexa-1,5-dien-1-ylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[4-(3,4,10,11-tetrahydro-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]aniline |
| SMILES | C1=CC(C2=CCC(N(c3ccccc3)c3ccc(-c4ccc(-n5c6c(c7c8oc9c(c8ccc75)C=CCC9)C=CCC6)cc4)cc3)C=C2)=CCC1 |
| InChI | InChI=1S/C48H40N2O/c1-3-11-33(12-4-1)34-19-25-38(26-20-34)49(37-13-5-2-6-14-37)39-27-21-35(22-28-39)36-23-29-40(30-24-36)50-44-17-9-7-16-43(44)47-45(50)32-31-42-41-15-8-10-18-46(41)51-48(42)47/h2-3,5-8,11-16,19-25,27-32,38H,1,4,9-10,17-18,26H2 |
| InChIKey | STBOENIATGSMFY-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 21.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |