C54H50N2 — CID 166953662
4-[4-(3-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-yl-1,2-dihydrocarbazol-9-yl)cyclohexa-1,3-dien-1-yl]-N-phenyl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline (PubChem CID 166953662) has the molecular formula C54H50N2 and a molecular weight of 727.01 g/mol. Its IUPAC name is 4-[4-(3-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-yl-1,2-dihydrocarbazol-9-yl)cyclohexa-1,3-dien-1-yl]-N-phenyl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline.
| Compound Name | 4-[4-(3-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-yl-1,2-dihydrocarbazol-9-yl)cyclohexa-1,3-dien-1-yl]-N-phenyl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline |
|---|---|
| PubChem CID | 166953662 |
| Molecular Formula | C54H50N2 |
| Molecular Weight | 727.01 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | 4-[4-(3-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-yl-1,2-dihydrocarbazol-9-yl)cyclohexa-1,3-dien-1-yl]-N-phenyl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline |
| SMILES | C1=CC(C2=Cc3c(n(C4=CC=C(c5ccc(N(c6ccccc6)C6C=CC(c7ccccc7)=CC6)cc5)CC4)c4ccc(C5CC=CCC5)cc34)CC2)=CCC1 |
| InChI | InChI=1S/C54H50N2/c1-5-13-39(14-6-1)42-21-29-48(30-22-42)55(47-19-11-4-12-20-47)49-31-23-43(24-32-49)44-25-33-50(34-26-44)56-53-35-27-45(40-15-7-2-8-16-40)37-51(53)52-38-46(28-36-54(52)56)41-17-9-3-10-18-41/h1-2,4-7,9,11-14,17-25,27,29,31-33,35,37-38,40,48H,3,8,10,15-16,26,28,30,34,36H2 |
| InChIKey | IUCMJZCCCLAYQL-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.01 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|