C25H40N4O5S — CID 144908123
ethyl 2-[5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)-2-(sulfanyloxymethyl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate;2-methylpropan-2-ol (PubChem CID 144908123) has the molecular formula C25H40N4O5S and a molecular weight of 508.69 g/mol. Its IUPAC name is ethyl 2-[5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)-2-(sulfanyloxymethyl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate;2-methylpropan-2-ol.
| Compound Name | ethyl 2-[5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)-2-(sulfanyloxymethyl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 144908123 |
| Molecular Formula | C25H40N4O5S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | ethyl 2-[5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)-2-(sulfanyloxymethyl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate;2-methylpropan-2-ol |
| SMILES | C=CCOC1(C)CCN(c2c(CC(=O)OCC)c(C)nc3cc(COS)nn23)CC1.CC(C)(C)O |
| InChI | InChI=1S/C21H30N4O4S.C4H10O/c1-5-11-28-21(4)7-9-24(10-8-21)20-17(13-19(26)27-6-2)15(3)22-18-12-16(14-29-30)23-25(18)20;1-4(2,3)5/h5,12,30H,1,6-11,13-14H2,2-4H3;5H,1-3H3 |
| InChIKey | OIBJQJQHXCFHLV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|