C27H41N7O4 — CID 144908154
ethyl 2-[2-[[amino-[(Z)-2-amino-3-prop-2-enoxyprop-1-enyl]amino]methyl]-5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate (PubChem CID 144908154) has the molecular formula C27H41N7O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is ethyl 2-[2-[[amino-[(Z)-2-amino-3-prop-2-enoxyprop-1-enyl]amino]methyl]-5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate.
| Compound Name | ethyl 2-[2-[[amino-[(Z)-2-amino-3-prop-2-enoxyprop-1-enyl]amino]methyl]-5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate |
|---|---|
| PubChem CID | 144908154 |
| Molecular Formula | C27H41N7O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | ethyl 2-[2-[[amino-[(Z)-2-amino-3-prop-2-enoxyprop-1-enyl]amino]methyl]-5-methyl-7-(4-methyl-4-prop-2-enoxypiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-6-yl]acetate |
| SMILES | C=CCOC/C(N)=C/N(N)Cc1cc2nc(C)c(CC(=O)OCC)c(N3CCC(C)(OCC=C)CC3)n2n1 |
| InChI | InChI=1S/C27H41N7O4/c1-6-13-36-19-21(28)17-33(29)18-22-15-24-30-20(4)23(16-25(35)37-8-3)26(34(24)31-22)32-11-9-27(5,10-12-32)38-14-7-2/h6-7,15,17H,1-2,8-14,16,18-19,28-29H2,3-5H3/b21-17- |
| InChIKey | QOEAGSHZWOGYPH-FXBPSFAMSA-N |
| XLogP | 2.38 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|