C30H24N2O5 — CID 144911620
6-[4-[(9-phenyl-1,2-dihydrocarbazol-3-yl)amino]phenyl]benzene-1,2,3,4,5-pentol (PubChem CID 144911620) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is 6-[4-[(9-phenyl-1,2-dihydrocarbazol-3-yl)amino]phenyl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-[(9-phenyl-1,2-dihydrocarbazol-3-yl)amino]phenyl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 144911620 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 6-[4-[(9-phenyl-1,2-dihydrocarbazol-3-yl)amino]phenyl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2ccc(NC3=Cc4c(n(-c5ccccc5)c5ccccc45)CC3)cc2)c(O)c1O |
| InChI | InChI=1S/C30H24N2O5/c33-26-25(27(34)29(36)30(37)28(26)35)17-10-12-18(13-11-17)31-19-14-15-24-22(16-19)21-8-4-5-9-23(21)32(24)20-6-2-1-3-7-20/h1-13,16,31,33-37H,14-15H2 |
| InChIKey | KNCQNXKEHIQSLN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|