ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate

C13H22O3 — CID 144911799

IUPACethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate
SMILESCC.CCOC(=O)C1=C(C(C)=O)CC(C)C1
InChIInChI=1S/C11H16O3.C2H6/c1-4-14-11(13)10-6-7(2)5-9(10)8(3)12;1-2/h7H,4-6H2,1-3H3;1-2H3
InChIKeyMYJADCAGUONOPS-UHFFFAOYSA-N
MW226.32 g/mol
LogP2.89
Rot. Bonds3

About ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate

ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate (PubChem CID 144911799) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate.

Molecular Properties

Compound Nameethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate
PubChem CID144911799
Molecular FormulaC13H22O3
Molecular Weight226.32 g/mol
Exact Mass226.16
IUPAC Nameethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate
SMILESCC.CCOC(=O)C1=C(C(C)=O)CC(C)C1
InChIInChI=1S/C11H16O3.C2H6/c1-4-14-11(13)10-6-7(2)5-9(10)8(3)12;1-2/h7H,4-6H2,1-3H3;1-2H3
InChIKeyMYJADCAGUONOPS-UHFFFAOYSA-N
XLogP2.89
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate?
The IUPAC name of ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate (CID 144911799) is ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate.
What is the SMILES notation for ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate?
The canonical SMILES for ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate is CC.CCOC(=O)C1=C(C(C)=O)CC(C)C1.
What is the InChIKey of ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate?
The InChIKey is MYJADCAGUONOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3.C2H6/c1-4-14-11(13)10-6-7(2)5-9(10)8(3)12;1-2/h7H,4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate?
ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate has a molecular weight of 226.32 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-acetyl-4-methylcyclopentene-1-carboxylate is sourced from PubChem (CID 144911799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).