C13H15ClF2N2O — CID 144912516
(4R)-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-1-methylpyrrolidine-2-carboxamide (PubChem CID 144912516) has the molecular formula C13H15ClF2N2O and a molecular weight of 288.73 g/mol. Its IUPAC name is (4R)-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-1-methylpyrrolidine-2-carboxamide.
| Compound Name | (4R)-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144912516 |
| Molecular Formula | C13H15ClF2N2O |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (4R)-N-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-1-methylpyrrolidine-2-carboxamide |
| SMILES | CN1C[C@H](F)CC1C(=O)NCc1cccc(Cl)c1F |
| InChI | InChI=1S/C13H15ClF2N2O/c1-18-7-9(15)5-11(18)13(19)17-6-8-3-2-4-10(14)12(8)16/h2-4,9,11H,5-7H2,1H3,(H,17,19)/t9-,11?/m1/s1 |
| InChIKey | OQFSMMROAWGKDS-BFHBGLAWSA-N |
| XLogP | 2.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |