C12H13ClF2N2O — CID 121416136
1-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 121416136) has the molecular formula C12H13ClF2N2O and a molecular weight of 274.70 g/mol. Its IUPAC name is 1-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | 1-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 121416136 |
| Molecular Formula | C12H13ClF2N2O |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-[(3-chloro-2-fluorophenyl)methyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CC(F)CN1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H13ClF2N2O/c13-9-3-1-2-7(11(9)15)5-17-6-8(14)4-10(17)12(16)18/h1-3,8,10H,4-6H2,(H2,16,18) |
| InChIKey | AHKQHAZTZMKDIA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |