C12H21N3O — CID 144914049
(8aS)-2-(3-methylcyclopentyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 144914049) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is (8aS)-2-(3-methylcyclopentyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aS)-2-(3-methylcyclopentyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 144914049 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (8aS)-2-(3-methylcyclopentyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CC1CCC(N2C[C@@H]3CNCCN3C2=O)C1 |
| InChI | InChI=1S/C12H21N3O/c1-9-2-3-10(6-9)15-8-11-7-13-4-5-14(11)12(15)16/h9-11,13H,2-8H2,1H3/t9?,10?,11-/m0/s1 |
| InChIKey | QNNZOWVGCDYJED-ILDUYXDCSA-N |
| XLogP | 0.88 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |