C22H33N3O2 — CID 144915464
4-(aminomethyl)-6-propan-2-ylbenzene-1,3-diol;4-(piperidin-4-ylmethyl)aniline (PubChem CID 144915464) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-(aminomethyl)-6-propan-2-ylbenzene-1,3-diol;4-(piperidin-4-ylmethyl)aniline.
| Compound Name | 4-(aminomethyl)-6-propan-2-ylbenzene-1,3-diol;4-(piperidin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 144915464 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 4-(aminomethyl)-6-propan-2-ylbenzene-1,3-diol;4-(piperidin-4-ylmethyl)aniline |
| SMILES | CC(C)c1cc(CN)c(O)cc1O.Nc1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C12H18N2.C10H15NO2/c13-12-3-1-10(2-4-12)9-11-5-7-14-8-6-11;1-6(2)8-3-7(5-11)9(12)4-10(8)13/h1-4,11,14H,5-9,13H2;3-4,6,12-13H,5,11H2,1-2H3 |
| InChIKey | RJQZRNXTLLJQKA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|