About 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol
2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol (PubChem CID 117441142) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol |
| PubChem CID | 117441142 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1ccc(C(C)C)c(CC2CCNCC2)c1O |
| InChI | InChI=1S/C18H29NO/c1-12(2)15-5-6-16(13(3)4)18(20)17(15)11-14-7-9-19-10-8-14/h5-6,12-14,19-20H,7-11H2,1-4H3 |
| InChIKey | OSMFGAAEXKYLMR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol?
The IUPAC name of 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol (CID 117441142) is 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol.
What is the SMILES notation for 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol?
The canonical SMILES for 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol is CC(C)c1ccc(C(C)C)c(CC2CCNCC2)c1O.
What is the InChIKey of 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol?
The InChIKey is OSMFGAAEXKYLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO/c1-12(2)15-5-6-16(13(3)4)18(20)17(15)11-14-7-9-19-10-8-14/h5-6,12-14,19-20H,7-11H2,1-4H3.
What are the key properties of 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol?
2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol has a molecular weight of 275.44 g/mol, XLogP of 4.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(piperidin-4-ylmethyl)-3,6-di(propan-2-yl)phenol is sourced from PubChem (CID 117441142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).