C15H19N3S2 — CID 144915973
N-methyl-4-(4-piperidin-1-ylsulfanylphenyl)-1,3-thiazol-2-amine (PubChem CID 144915973) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is N-methyl-4-(4-piperidin-1-ylsulfanylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-4-(4-piperidin-1-ylsulfanylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144915973 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-methyl-4-(4-piperidin-1-ylsulfanylphenyl)-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2ccc(SN3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C15H19N3S2/c1-16-15-17-14(11-19-15)12-5-7-13(8-6-12)20-18-9-3-2-4-10-18/h5-8,11H,2-4,9-10H2,1H3,(H,16,17) |
| InChIKey | DOWNOQFCALBOLK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|