C19H19N5O2 — CID 144918208
14-imino-7-oxa-10,19,20,23-tetrazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2(24),3,5,16(23),17,20-heptaen-15-one (PubChem CID 144918208) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 14-imino-7-oxa-10,19,20,23-tetrazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2(24),3,5,16(23),17,20-heptaen-15-one.
| Compound Name | 14-imino-7-oxa-10,19,20,23-tetrazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2(24),3,5,16(23),17,20-heptaen-15-one |
|---|---|
| PubChem CID | 144918208 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 14-imino-7-oxa-10,19,20,23-tetrazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2(24),3,5,16(23),17,20-heptaen-15-one |
| SMILES | [H]/N=C1/CCCNCCOc2cccc(c2)-c2cnn3ccc(nc23)C1=O |
| InChI | InChI=1S/C19H19N5O2/c20-16-5-2-7-21-8-10-26-14-4-1-3-13(11-14)15-12-22-24-9-6-17(18(16)25)23-19(15)24/h1,3-4,6,9,11-12,20-21H,2,5,7-8,10H2/b20-16- |
| InChIKey | SLTWJZFSOCCNJS-SILNSSARSA-N |
| XLogP | 2.36 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|