C19H22N2O3 — CID 144921221
(3S)-1-benzyl-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperazine-2,5-dione (PubChem CID 144921221) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3S)-1-benzyl-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperazine-2,5-dione.
| Compound Name | (3S)-1-benzyl-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 144921221 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3S)-1-benzyl-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperazine-2,5-dione |
| SMILES | C=C/C=C(\C=C)COC[C@@H]1NC(=O)CN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H22N2O3/c1-3-8-15(4-2)13-24-14-17-19(23)21(12-18(22)20-17)11-16-9-6-5-7-10-16/h3-10,17H,1-2,11-14H2,(H,20,22)/b15-8+/t17-/m0/s1 |
| InChIKey | FDZKGNCWJVDYQR-BXUGYJKXSA-N |
| XLogP | 1.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|