C11H20N2 — CID 144921620
(1E)-3-methyl-1-(4-methylpiperidin-1-yl)buta-1,3-dien-1-amine (PubChem CID 144921620) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (1E)-3-methyl-1-(4-methylpiperidin-1-yl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-3-methyl-1-(4-methylpiperidin-1-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144921620 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (1E)-3-methyl-1-(4-methylpiperidin-1-yl)buta-1,3-dien-1-amine |
| SMILES | C=C(C)/C=C(\N)N1CCC(C)CC1 |
| InChI | InChI=1S/C11H20N2/c1-9(2)8-11(12)13-6-4-10(3)5-7-13/h8,10H,1,4-7,12H2,2-3H3/b11-8+ |
| InChIKey | BPVHDYAWMRCLQF-DHZHZOJOSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|