C17H33N3 — CID 142187232
(1E,3E)-1-[3-[(dimethylamino)methyl]piperidin-1-yl]-3-methylhexa-1,3,5-trien-1-amine;ethane (PubChem CID 142187232) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is (1E,3E)-1-[3-[(dimethylamino)methyl]piperidin-1-yl]-3-methylhexa-1,3,5-trien-1-amine;ethane.
| Compound Name | (1E,3E)-1-[3-[(dimethylamino)methyl]piperidin-1-yl]-3-methylhexa-1,3,5-trien-1-amine;ethane |
|---|---|
| PubChem CID | 142187232 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | (1E,3E)-1-[3-[(dimethylamino)methyl]piperidin-1-yl]-3-methylhexa-1,3,5-trien-1-amine;ethane |
| SMILES | C=C/C=C(C)/C=C(\N)N1CCCC(CN(C)C)C1.CC |
| InChI | InChI=1S/C15H27N3.C2H6/c1-5-7-13(2)10-15(16)18-9-6-8-14(12-18)11-17(3)4;1-2/h5,7,10,14H,1,6,8-9,11-12,16H2,2-4H3;1-2H3/b13-7+,15-10+; |
| InChIKey | JRZRZKKRWJTGOL-CMAJRGDMSA-N |
| XLogP | 3.22 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|