C5H3F9S — CID 14492232
2,2,3,3,4,4,5,5,5-nonafluoropentane-1-thiol (PubChem CID 14492232) has the molecular formula C5H3F9S and a molecular weight of 266.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-thiol.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-thiol |
|---|---|
| PubChem CID | 14492232 |
| Molecular Formula | C5H3F9S |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-thiol |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CS |
| InChI | InChI=1S/C5H3F9S/c6-2(7,1-15)3(8,9)4(10,11)5(12,13)14/h15H,1H2 |
| InChIKey | BKRGMSAQLNOXNF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|