C14H32N2O3S — CID 144923798
[3-[[ethyl(methyl)amino]methoxy]-3-methylbutyl]carbamic acid;2-methylpropane-2-thiol (PubChem CID 144923798) has the molecular formula C14H32N2O3S and a molecular weight of 308.49 g/mol. Its IUPAC name is [3-[[ethyl(methyl)amino]methoxy]-3-methylbutyl]carbamic acid;2-methylpropane-2-thiol.
| Compound Name | [3-[[ethyl(methyl)amino]methoxy]-3-methylbutyl]carbamic acid;2-methylpropane-2-thiol |
|---|---|
| PubChem CID | 144923798 |
| Molecular Formula | C14H32N2O3S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [3-[[ethyl(methyl)amino]methoxy]-3-methylbutyl]carbamic acid;2-methylpropane-2-thiol |
| SMILES | CC(C)(C)S.CCN(C)COC(C)(C)CCNC(=O)O |
| InChI | InChI=1S/C10H22N2O3.C4H10S/c1-5-12(4)8-15-10(2,3)6-7-11-9(13)14;1-4(2,3)5/h11H,5-8H2,1-4H3,(H,13,14);5H,1-3H3 |
| InChIKey | QHFWFBNKWFAKPH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|