C25H25N2OP — CID 144924325
diphenyl-[(2S)-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidin-1-yl]phosphane (PubChem CID 144924325) has the molecular formula C25H25N2OP and a molecular weight of 400.46 g/mol. Its IUPAC name is diphenyl-[(2S)-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidin-1-yl]phosphane.
| Compound Name | diphenyl-[(2S)-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidin-1-yl]phosphane |
|---|---|
| PubChem CID | 144924325 |
| Molecular Formula | C25H25N2OP |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | diphenyl-[(2S)-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidin-1-yl]phosphane |
| SMILES | c1ccc(C2COC([C@@H]3CCCN3P(c3ccccc3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C25H25N2OP/c1-4-11-20(12-5-1)23-19-28-25(26-23)24-17-10-18-27(24)29(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23-24H,10,17-19H2/t23?,24-/m0/s1 |
| InChIKey | QAKHCVSFJZYUCE-CGAIIQECSA-N |
| XLogP | 4.67 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|