C54H43N3 — CID 144924857
(E)-2-[(Z)-2-amino-2-[3-[7-[3-[(2E)-3-cyanopenta-2,4-dienyl]phenyl]-5-ethenyl-9,9-diphenyl-6-[(Z)-prop-1-enyl]fluoren-2-yl]phenyl]ethenyl]but-2-enenitrile (PubChem CID 144924857) has the molecular formula C54H43N3 and a molecular weight of 733.96 g/mol. Its IUPAC name is (E)-2-[(Z)-2-amino-2-[3-[7-[3-[(2E)-3-cyanopenta-2,4-dienyl]phenyl]-5-ethenyl-9,9-diphenyl-6-[(Z)-prop-1-enyl]fluoren-2-yl]phenyl]ethenyl]but-2-enenitrile.
| Compound Name | (E)-2-[(Z)-2-amino-2-[3-[7-[3-[(2E)-3-cyanopenta-2,4-dienyl]phenyl]-5-ethenyl-9,9-diphenyl-6-[(Z)-prop-1-enyl]fluoren-2-yl]phenyl]ethenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 144924857 |
| Molecular Formula | C54H43N3 |
| Molecular Weight | 733.96 g/mol |
| Exact Mass | 733.35 |
| IUPAC Name | (E)-2-[(Z)-2-amino-2-[3-[7-[3-[(2E)-3-cyanopenta-2,4-dienyl]phenyl]-5-ethenyl-9,9-diphenyl-6-[(Z)-prop-1-enyl]fluoren-2-yl]phenyl]ethenyl]but-2-enenitrile |
| SMILES | C=C/C(C#N)=C\Cc1cccc(-c2cc3c(c(C=C)c2/C=C\C)-c2ccc(-c4cccc(/C(N)=C/C(C#N)=C\C)c4)cc2C3(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C54H43N3/c1-5-17-47-46(8-4)53-48-29-28-41(40-19-16-21-43(32-40)52(57)31-38(7-3)36-56)33-50(48)54(44-22-11-9-12-23-44,45-24-13-10-14-25-45)51(53)34-49(47)42-20-15-18-39(30-42)27-26-37(6-2)35-55/h5-26,28-34H,2,4,27,57H2,1,3H3/b17-5-,37-26+,38-7+,52-31- |
| InChIKey | HJIXRSMZWMDMEB-IAAWJERISA-N |
| XLogP | 13.01 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.96 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|