C40H29N — CID 144925274
(2E)-3-(7,7,9-triphenylbenzo[c]fluoren-5-yl)penta-2,4-dien-1-imine (PubChem CID 144925274) has the molecular formula C40H29N and a molecular weight of 523.68 g/mol. Its IUPAC name is (2E)-3-(7,7,9-triphenylbenzo[c]fluoren-5-yl)penta-2,4-dien-1-imine.
| Compound Name | (2E)-3-(7,7,9-triphenylbenzo[c]fluoren-5-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144925274 |
| Molecular Formula | C40H29N |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | (2E)-3-(7,7,9-triphenylbenzo[c]fluoren-5-yl)penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(\C=C)c1cc2c(c3ccccc13)-c1ccc(-c3ccccc3)cc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H29N/c1-2-28(24-25-41)36-27-38-39(34-21-13-12-20-33(34)36)35-23-22-30(29-14-6-3-7-15-29)26-37(35)40(38,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h2-27,41H,1H2/b28-24+,41-25+ |
| InChIKey | HXNCABPYFCWVLF-NGBODXQISA-N |
| XLogP | 10.09 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|