C22H16F6N2O3 — CID 144927264
2-[1,1-difluoro-2-(2-fluoro-4-methylphenyl)-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 144927264) has the molecular formula C22H16F6N2O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is 2-[1,1-difluoro-2-(2-fluoro-4-methylphenyl)-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 2-[1,1-difluoro-2-(2-fluoro-4-methylphenyl)-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 144927264 |
| Molecular Formula | C22H16F6N2O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-[1,1-difluoro-2-(2-fluoro-4-methylphenyl)-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | Cc1ccc(C(C[N+](=O)[O-])C(F)(F)c2ccc(-c3ccc(OC(F)(F)F)cc3)cn2)c(F)c1 |
| InChI | InChI=1S/C22H16F6N2O3/c1-13-2-8-17(19(23)10-13)18(12-30(31)32)21(24,25)20-9-5-15(11-29-20)14-3-6-16(7-4-14)33-22(26,27)28/h2-11,18H,12H2,1H3 |
| InChIKey | RRZKGLSIEBGIGJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|