C20H16F3N5 — CID 144929207
N-[3-imino-3-(2-methyl-5-pyridin-3-ylphenyl)prop-1-en-2-yl]-2-(trifluoromethyl)pyrimidin-5-amine (PubChem CID 144929207) has the molecular formula C20H16F3N5 and a molecular weight of 383.38 g/mol. Its IUPAC name is N-[3-imino-3-(2-methyl-5-pyridin-3-ylphenyl)prop-1-en-2-yl]-2-(trifluoromethyl)pyrimidin-5-amine.
| Compound Name | N-[3-imino-3-(2-methyl-5-pyridin-3-ylphenyl)prop-1-en-2-yl]-2-(trifluoromethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 144929207 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[3-imino-3-(2-methyl-5-pyridin-3-ylphenyl)prop-1-en-2-yl]-2-(trifluoromethyl)pyrimidin-5-amine |
| SMILES | [H]/N=C(\C(=C)Nc1cnc(C(F)(F)F)nc1)c1cc(-c2cccnc2)ccc1C |
| InChI | InChI=1S/C20H16F3N5/c1-12-5-6-14(15-4-3-7-25-9-15)8-17(12)18(24)13(2)28-16-10-26-19(27-11-16)20(21,22)23/h3-11,24,28H,2H2,1H3/b24-18+ |
| InChIKey | GDITXBFMVWAVSH-HKOYGPOVSA-N |
| XLogP | 4.86 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|