About ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate
ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 144929756) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate |
| PubChem CID | 144929756 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | CC.COC(=O)N1[C@H](C)CN(c2ccc(C)cn2)C[C@@H]1C |
| InChI | InChI=1S/C14H21N3O2.C2H6/c1-10-5-6-13(15-7-10)16-8-11(2)17(12(3)9-16)14(18)19-4;1-2/h5-7,11-12H,8-9H2,1-4H3;1-2H3/t11-,12+; |
| InChIKey | LHJZMBOGSGCPOO-IWKKHLOMSA-N |
| XLogP | 3.08 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate?
The IUPAC name of ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate (CID 144929756) is ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate.
What is the SMILES notation for ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate?
The canonical SMILES for ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate is CC.COC(=O)N1[C@H](C)CN(c2ccc(C)cn2)C[C@@H]1C.
What is the InChIKey of ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate?
The InChIKey is LHJZMBOGSGCPOO-IWKKHLOMSA-N. The full InChI is InChI=1S/C14H21N3O2.C2H6/c1-10-5-6-13(15-7-10)16-8-11(2)17(12(3)9-16)14(18)19-4;1-2/h5-7,11-12H,8-9H2,1-4H3;1-2H3/t11-,12+;.
What are the key properties of ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate?
ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate has a molecular weight of 293.41 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl (2S,6R)-2,6-dimethyl-4-(5-methyl-2-pyridinyl)piperazine-1-carboxylate is sourced from PubChem (CID 144929756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).