C32H33N5O2 — CID 144929971
4-(4-cyclopropyl-3-methylquinolin-8-yl)benzonitrile;N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]formamide (PubChem CID 144929971) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-(4-cyclopropyl-3-methylquinolin-8-yl)benzonitrile;N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]formamide.
| Compound Name | 4-(4-cyclopropyl-3-methylquinolin-8-yl)benzonitrile;N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 144929971 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-(4-cyclopropyl-3-methylquinolin-8-yl)benzonitrile;N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]formamide |
| SMILES | CC1CN(c2ccc(NC=O)cn2)CC(C)O1.Cc1cnc2c(-c3ccc(C#N)cc3)cccc2c1C1CC1 |
| InChI | InChI=1S/C20H16N2.C12H17N3O2/c1-13-12-22-20-17(15-7-5-14(11-21)6-8-15)3-2-4-18(20)19(13)16-9-10-16;1-9-6-15(7-10(2)17-9)12-4-3-11(5-13-12)14-8-16/h2-8,12,16H,9-10H2,1H3;3-5,8-10H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | CLOHIFYLCOBJLF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|