C29H27N5O3 — CID 140791786
N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-8-(4-isocyanophenyl)-4-methoxyquinoline-3-carboxamide (PubChem CID 140791786) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-8-(4-isocyanophenyl)-4-methoxyquinoline-3-carboxamide.
| Compound Name | N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-8-(4-isocyanophenyl)-4-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 140791786 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-8-(4-isocyanophenyl)-4-methoxyquinoline-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(OC)c(C(=O)Nc4ccc(N5C[C@@H](C)O[C@@H](C)C5)nc4)cnc23)cc1 |
| InChI | InChI=1S/C29H27N5O3/c1-18-16-34(17-19(2)37-18)26-13-12-22(14-31-26)33-29(35)25-15-32-27-23(6-5-7-24(27)28(25)36-4)20-8-10-21(30-3)11-9-20/h5-15,18-19H,16-17H2,1-2,4H3,(H,33,35)/t18-,19+ |
| InChIKey | IAVYJVVLZTUTCB-KDURUIRLSA-N |
| XLogP | 5.72 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|