C27H24N4O2 — CID 140791891
2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5-(4-isocyanophenyl)isoquinolin-1-one (PubChem CID 140791891) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5-(4-isocyanophenyl)isoquinolin-1-one.
| Compound Name | 2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5-(4-isocyanophenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 140791891 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5-(4-isocyanophenyl)isoquinolin-1-one |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(=O)n(-c4ccc(N5C[C@@H](C)O[C@@H](C)C5)nc4)ccc23)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-18-16-30(17-19(2)33-18)26-12-11-22(15-29-26)31-14-13-24-23(5-4-6-25(24)27(31)32)20-7-9-21(28-3)10-8-20/h4-15,18-19H,16-17H2,1-2H3/t18-,19+ |
| InChIKey | MNWVMFFSDDIJHT-KDURUIRLSA-N |
| XLogP | 5.22 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|