C30H27N3O3 — CID 140791922
methyl 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-8-(4-isocyanophenyl)quinoline-4-carboxylate (PubChem CID 140791922) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is methyl 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-8-(4-isocyanophenyl)quinoline-4-carboxylate.
| Compound Name | methyl 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-8-(4-isocyanophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 140791922 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | methyl 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-8-(4-isocyanophenyl)quinoline-4-carboxylate |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(C(=O)OC)c(-c4ccc(N5C[C@@H](C)O[C@@H](C)C5)cc4)cnc23)cc1 |
| InChI | InChI=1S/C30H27N3O3/c1-19-17-33(18-20(2)36-19)24-14-10-22(11-15-24)27-16-32-29-25(21-8-12-23(31-3)13-9-21)6-5-7-26(29)28(27)30(34)35-4/h5-16,19-20H,17-18H2,1-2,4H3/t19-,20+ |
| InChIKey | WWTYINDSKLHKFR-BGYRXZFFSA-N |
| XLogP | 6.52 |
| TPSA | 56.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|