C30H29N5O — CID 140791875
(2S,6R)-4-[5-[4-(azetidin-1-yl)-8-(4-isocyanophenyl)quinolin-3-yl]-2-pyridinyl]-2,6-dimethylmorpholine (PubChem CID 140791875) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is (2S,6R)-4-[5-[4-(azetidin-1-yl)-8-(4-isocyanophenyl)quinolin-3-yl]-2-pyridinyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[5-[4-(azetidin-1-yl)-8-(4-isocyanophenyl)quinolin-3-yl]-2-pyridinyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 140791875 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (2S,6R)-4-[5-[4-(azetidin-1-yl)-8-(4-isocyanophenyl)quinolin-3-yl]-2-pyridinyl]-2,6-dimethylmorpholine |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(N4CCC4)c(-c4ccc(N5C[C@@H](C)O[C@@H](C)C5)nc4)cnc23)cc1 |
| InChI | InChI=1S/C30H29N5O/c1-20-18-35(19-21(2)36-20)28-13-10-23(16-32-28)27-17-33-29-25(22-8-11-24(31-3)12-9-22)6-4-7-26(29)30(27)34-14-5-15-34/h4,6-13,16-17,20-21H,5,14-15,18-19H2,1-2H3/t20-,21+ |
| InChIKey | PLLQCLHTCIZPFT-OYRHEFFESA-N |
| XLogP | 6.34 |
| TPSA | 45.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|