C28H32N4O2 — CID 140791776
(2R,6S)-4-[1-[8-(4-isocyanophenyl)-4-methoxyquinolin-3-yl]piperidin-4-yl]-2,6-dimethylmorpholine (PubChem CID 140791776) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (2R,6S)-4-[1-[8-(4-isocyanophenyl)-4-methoxyquinolin-3-yl]piperidin-4-yl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[1-[8-(4-isocyanophenyl)-4-methoxyquinolin-3-yl]piperidin-4-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 140791776 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (2R,6S)-4-[1-[8-(4-isocyanophenyl)-4-methoxyquinolin-3-yl]piperidin-4-yl]-2,6-dimethylmorpholine |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(OC)c(N4CCC(N5C[C@@H](C)O[C@@H](C)C5)CC4)cnc23)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-19-17-32(18-20(2)34-19)23-12-14-31(15-13-23)26-16-30-27-24(6-5-7-25(27)28(26)33-4)21-8-10-22(29-3)11-9-21/h5-11,16,19-20,23H,12-15,17-18H2,1-2,4H3/t19-,20+ |
| InChIKey | UCSKWWBVQVUHRG-BGYRXZFFSA-N |
| XLogP | 5.54 |
| TPSA | 42.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|