About 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile
4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile (PubChem CID 118407401) has the molecular formula C28H27N5O
and a molecular weight of 449.56 g/mol. Its IUPAC name is 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile |
| PubChem CID | 118407401 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile |
| SMILES | COc1c(N2CCN(c3cc(C)nc(C)c3)CC2)cnc2c(-c3ccc(C#N)cc3)cccc12 |
| InChI | InChI=1S/C28H27N5O/c1-19-15-23(16-20(2)31-19)32-11-13-33(14-12-32)26-18-30-27-24(5-4-6-25(27)28(26)34-3)22-9-7-21(17-29)8-10-22/h4-10,15-16,18H,11-14H2,1-3H3 |
| InChIKey | GRBXQXTWMSBLKH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile?
The IUPAC name of 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile (CID 118407401) is 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile.
What is the SMILES notation for 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile?
The canonical SMILES for 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile is COc1c(N2CCN(c3cc(C)nc(C)c3)CC2)cnc2c(-c3ccc(C#N)cc3)cccc12.
What is the InChIKey of 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile?
The InChIKey is GRBXQXTWMSBLKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N5O/c1-19-15-23(16-20(2)31-19)32-11-13-33(14-12-32)26-18-30-27-24(5-4-6-25(27)28(26)34-3)22-9-7-21(17-29)8-10-22/h4-10,15-16,18H,11-14H2,1-3H3.
What are the key properties of 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile?
4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile has a molecular weight of 449.56 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile is sourced from PubChem (CID 118407401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).