C28H25N5O2 — CID 118407226
4-[4-methoxy-3-[4-(2-pyridin-4-ylacetyl)piperazin-1-yl]quinolin-8-yl]benzonitrile (PubChem CID 118407226) has the molecular formula C28H25N5O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-[4-methoxy-3-[4-(2-pyridin-4-ylacetyl)piperazin-1-yl]quinolin-8-yl]benzonitrile.
| Compound Name | 4-[4-methoxy-3-[4-(2-pyridin-4-ylacetyl)piperazin-1-yl]quinolin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 118407226 |
| Molecular Formula | C28H25N5O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4-[4-methoxy-3-[4-(2-pyridin-4-ylacetyl)piperazin-1-yl]quinolin-8-yl]benzonitrile |
| SMILES | COc1c(N2CCN(C(=O)Cc3ccncc3)CC2)cnc2c(-c3ccc(C#N)cc3)cccc12 |
| InChI | InChI=1S/C28H25N5O2/c1-35-28-24-4-2-3-23(22-7-5-21(18-29)6-8-22)27(24)31-19-25(28)32-13-15-33(16-14-32)26(34)17-20-9-11-30-12-10-20/h2-12,19H,13-17H2,1H3 |
| InChIKey | JUJIVAHEZFIKPM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |