C28H26N4O3 — CID 126517958
ethyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate (PubChem CID 126517958) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is ethyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 126517958 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNc1ccc(-c2cnc3c(-c4ccc(C#N)cc4)cccc3c2OC)cc1 |
| InChI | InChI=1S/C28H26N4O3/c1-3-35-28(33)31-16-15-30-22-13-11-21(12-14-22)25-18-32-26-23(5-4-6-24(26)27(25)34-2)20-9-7-19(17-29)8-10-20/h4-14,18,30H,3,15-16H2,1-2H3,(H,31,33) |
| InChIKey | IVVANFGGWIPKRM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|