C29H28N4O3 — CID 126518188
propyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate (PubChem CID 126518188) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is propyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate.
| Compound Name | propyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 126518188 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | propyl N-[2-[4-[8-(4-cyanophenyl)-4-methoxyquinolin-3-yl]anilino]ethyl]carbamate |
| SMILES | CCCOC(=O)NCCNc1ccc(-c2cnc3c(-c4ccc(C#N)cc4)cccc3c2OC)cc1 |
| InChI | InChI=1S/C29H28N4O3/c1-3-17-36-29(34)32-16-15-31-23-13-11-22(12-14-23)26-19-33-27-24(5-4-6-25(27)28(26)35-2)21-9-7-20(18-30)8-10-21/h4-14,19,31H,3,15-17H2,1-2H3,(H,32,34) |
| InChIKey | CAMQNCZPKCJTEF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|