C28H26N4O2 — CID 140791847
7-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(4-isocyanophenyl)-5-methyl-1,7-naphthyridin-8-one (PubChem CID 140791847) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 7-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(4-isocyanophenyl)-5-methyl-1,7-naphthyridin-8-one.
| Compound Name | 7-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(4-isocyanophenyl)-5-methyl-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 140791847 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 7-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(4-isocyanophenyl)-5-methyl-1,7-naphthyridin-8-one |
| SMILES | [C-]#[N+]c1ccc(-c2ccnc3c(=O)n(-c4ccc(N5C[C@@H](C)O[C@@H](C)C5)cc4)cc(C)c23)cc1 |
| InChI | InChI=1S/C28H26N4O2/c1-18-15-32(24-11-9-23(10-12-24)31-16-19(2)34-20(3)17-31)28(33)27-26(18)25(13-14-30-27)21-5-7-22(29-4)8-6-21/h5-15,19-20H,16-17H2,1-3H3/t19-,20+ |
| InChIKey | UZSZOORACLZFKS-BGYRXZFFSA-N |
| XLogP | 5.53 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|