C12H16Cl3N3OZn — CID 118856656
4-(2,6-dimethylmorpholin-4-yl)benzenediazonium;trichlorozinc(1-) (PubChem CID 118856656) has the molecular formula C12H16Cl3N3OZn and a molecular weight of 390.03 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)benzenediazonium;trichlorozinc(1-).
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)benzenediazonium;trichlorozinc(1-) |
|---|---|
| PubChem CID | 118856656 |
| Molecular Formula | C12H16Cl3N3OZn |
| Molecular Weight | 390.03 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)benzenediazonium;trichlorozinc(1-) |
| SMILES | CC1CN(c2ccc([N+]#N)cc2)CC(C)O1.Cl[Zn-](Cl)Cl |
| InChI | InChI=1S/C12H16N3O.3ClH.Zn/c1-9-7-15(8-10(2)16-9)12-5-3-11(14-13)4-6-12;;;;/h3-6,9-10H,7-8H2,1-2H3;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | RQOVIHNEOPKPDB-UHFFFAOYSA-K |
| XLogP | 4.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|