C33H34N4O — CID 118407012
4-[2-[4-[4-(cyclopropylmethyl)-3,5-dimethylpiperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile (PubChem CID 118407012) has the molecular formula C33H34N4O and a molecular weight of 502.66 g/mol. Its IUPAC name is 4-[2-[4-[4-(cyclopropylmethyl)-3,5-dimethylpiperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile.
| Compound Name | 4-[2-[4-[4-(cyclopropylmethyl)-3,5-dimethylpiperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 118407012 |
| Molecular Formula | C33H34N4O |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 4-[2-[4-[4-(cyclopropylmethyl)-3,5-dimethylpiperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile |
| SMILES | Cc1cn(-c2ccc(N3CC(C)N(CC4CC4)C(C)C3)cc2)c(=O)c2cccc(-c3ccc(C#N)cc3)c12 |
| InChI | InChI=1S/C33H34N4O/c1-22-18-37(33(38)31-6-4-5-30(32(22)31)27-11-9-25(17-34)10-12-27)29-15-13-28(14-16-29)35-19-23(2)36(24(3)20-35)21-26-7-8-26/h4-6,9-16,18,23-24,26H,7-8,19-21H2,1-3H3 |
| InChIKey | JNGBCMZMYOGLFI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|