C31H29F3N6O — CID 172944915
4-[2-[4-[3,5-dimethyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile (PubChem CID 172944915) has the molecular formula C31H29F3N6O and a molecular weight of 558.61 g/mol. Its IUPAC name is 4-[2-[4-[3,5-dimethyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile.
| Compound Name | 4-[2-[4-[3,5-dimethyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 172944915 |
| Molecular Formula | C31H29F3N6O |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 4-[2-[4-[3,5-dimethyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile |
| SMILES | Cc1cn(-c2ccc(N3CC(C)N(/C(=N\N)C(F)(F)F)C(C)C3)cc2)c(=O)c2cccc(-c3ccc(C#N)cc3)c12 |
| InChI | InChI=1S/C31H29F3N6O/c1-19-16-39(29(41)27-6-4-5-26(28(19)27)23-9-7-22(15-35)8-10-23)25-13-11-24(12-14-25)38-17-20(2)40(21(3)18-38)30(37-36)31(32,33)34/h4-14,16,20-21H,17-18,36H2,1-3H3/b37-30- |
| InChIKey | PTZFWYGPEALETH-ONQIKCEGSA-N |
| XLogP | 5.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|