C32H35N5O2 — CID 139470604
4-[4-[[(Z)-2-[2-(4-cyanophenyl)-6-formylphenyl]prop-1-enyl]-methylamino]phenyl]-N,2,6-trimethylpiperazine-1-carboxamide (PubChem CID 139470604) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 4-[4-[[(Z)-2-[2-(4-cyanophenyl)-6-formylphenyl]prop-1-enyl]-methylamino]phenyl]-N,2,6-trimethylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[[(Z)-2-[2-(4-cyanophenyl)-6-formylphenyl]prop-1-enyl]-methylamino]phenyl]-N,2,6-trimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 139470604 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 4-[4-[[(Z)-2-[2-(4-cyanophenyl)-6-formylphenyl]prop-1-enyl]-methylamino]phenyl]-N,2,6-trimethylpiperazine-1-carboxamide |
| SMILES | CNC(=O)N1C(C)CN(c2ccc(N(C)/C=C(/C)c3c(C=O)cccc3-c3ccc(C#N)cc3)cc2)CC1C |
| InChI | InChI=1S/C32H35N5O2/c1-22(31-27(21-38)7-6-8-30(31)26-11-9-25(17-33)10-12-26)18-35(5)28-13-15-29(16-14-28)36-19-23(2)37(24(3)20-36)32(39)34-4/h6-16,18,21,23-24H,19-20H2,1-5H3,(H,34,39)/b22-18- |
| InChIKey | JLTOFPNRHGFVER-PYCFMQQDSA-N |
| XLogP | 5.77 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|