C39H45N3O2 — CID 144929776
4-[2-[4-[4-(5,5-dimethyl-4-oxohexan-2-yl)-3,6-dimethylazepan-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile (PubChem CID 144929776) has the molecular formula C39H45N3O2 and a molecular weight of 587.81 g/mol. Its IUPAC name is 4-[2-[4-[4-(5,5-dimethyl-4-oxohexan-2-yl)-3,6-dimethylazepan-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile.
| Compound Name | 4-[2-[4-[4-(5,5-dimethyl-4-oxohexan-2-yl)-3,6-dimethylazepan-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 144929776 |
| Molecular Formula | C39H45N3O2 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 4-[2-[4-[4-(5,5-dimethyl-4-oxohexan-2-yl)-3,6-dimethylazepan-1-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]benzonitrile |
| SMILES | Cc1cn(-c2ccc(N3CC(C)CC(C(C)CC(=O)C(C)(C)C)C(C)C3)cc2)c(=O)c2cccc(-c3ccc(C#N)cc3)c12 |
| InChI | InChI=1S/C39H45N3O2/c1-25-19-35(26(2)20-36(43)39(5,6)7)27(3)23-41(22-25)31-15-17-32(18-16-31)42-24-28(4)37-33(9-8-10-34(37)38(42)44)30-13-11-29(21-40)12-14-30/h8-18,24-27,35H,19-20,22-23H2,1-7H3 |
| InChIKey | PQPXZSPXSOFQAB-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|