C28H26N4O2 — CID 118407267
6-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]pyridine-3-carbonitrile (PubChem CID 118407267) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 6-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118407267 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 6-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-4-methyl-1-oxoisoquinolin-5-yl]pyridine-3-carbonitrile |
| SMILES | Cc1cn(-c2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2)c(=O)c2cccc(-c3ccc(C#N)cn3)c12 |
| InChI | InChI=1S/C28H26N4O2/c1-18-15-32(23-10-8-22(9-11-23)31-16-19(2)34-20(3)17-31)28(33)25-6-4-5-24(27(18)25)26-12-7-21(13-29)14-30-26/h4-12,14-15,19-20H,16-17H2,1-3H3/t19-,20+ |
| InChIKey | MAMFXVSJWTWOLU-BGYRXZFFSA-N |
| XLogP | 4.85 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|