C28H25F3N2O3 — CID 139470820
2-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-5-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one (PubChem CID 139470820) has the molecular formula C28H25F3N2O3 and a molecular weight of 494.51 g/mol. Its IUPAC name is 2-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-5-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one.
| Compound Name | 2-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-5-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 139470820 |
| Molecular Formula | C28H25F3N2O3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-5-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one |
| SMILES | CC1CN(c2ccc(-n3ccc4c(-c5ccc(OC(F)(F)F)cc5)cccc4c3=O)cc2)CC(C)O1 |
| InChI | InChI=1S/C28H25F3N2O3/c1-18-16-32(17-19(2)35-18)21-8-10-22(11-9-21)33-15-14-25-24(4-3-5-26(25)27(33)34)20-6-12-23(13-7-20)36-28(29,30)31/h3-15,18-19H,16-17H2,1-2H3 |
| InChIKey | ZIKSTTLWOGHICN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|