C28H24FN3O3S — CID 144931660
2-[3-fluoro-7,10-dimethyl-6-methylsulfanyl-9-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid (PubChem CID 144931660) has the molecular formula C28H24FN3O3S and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-[3-fluoro-7,10-dimethyl-6-methylsulfanyl-9-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid.
| Compound Name | 2-[3-fluoro-7,10-dimethyl-6-methylsulfanyl-9-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid |
|---|---|
| PubChem CID | 144931660 |
| Molecular Formula | C28H24FN3O3S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-[3-fluoro-7,10-dimethyl-6-methylsulfanyl-9-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid |
| SMILES | CSN1Cc2cc(F)cnc2-c2c(C)c(-c3ccc4c5c(ccnc35)CCO4)c(CC(=O)O)c(C)c21 |
| InChI | InChI=1S/C28H24FN3O3S/c1-14-20(11-22(33)34)23(19-4-5-21-25-16(7-9-35-21)6-8-30-27(19)25)15(2)24-26-17(10-18(29)12-31-26)13-32(36-3)28(14)24/h4-6,8,10,12H,7,9,11,13H2,1-3H3,(H,33,34) |
| InChIKey | WYZGZAMYLQSAQP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|