C27H29NO3S — CID 144932293
2-[8-methoxy-4-methyl-2-(4-methylphenyl)-5-propan-2-ylsulfanyl-6H-phenanthridin-3-yl]acetic acid (PubChem CID 144932293) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-[8-methoxy-4-methyl-2-(4-methylphenyl)-5-propan-2-ylsulfanyl-6H-phenanthridin-3-yl]acetic acid.
| Compound Name | 2-[8-methoxy-4-methyl-2-(4-methylphenyl)-5-propan-2-ylsulfanyl-6H-phenanthridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 144932293 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[8-methoxy-4-methyl-2-(4-methylphenyl)-5-propan-2-ylsulfanyl-6H-phenanthridin-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)CN(SC(C)C)c1c-2cc(-c2ccc(C)cc2)c(CC(=O)O)c1C |
| InChI | InChI=1S/C27H29NO3S/c1-16(2)32-28-15-20-12-21(31-5)10-11-22(20)25-13-24(19-8-6-17(3)7-9-19)23(14-26(29)30)18(4)27(25)28/h6-13,16H,14-15H2,1-5H3,(H,29,30) |
| InChIKey | MCHWESJEAJLTIA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|